C11H13N5O4 — CID 115696998
2-[(4-cyano-3-nitro-2-pyridinyl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 115696998) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[(4-cyano-3-nitro-2-pyridinyl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4-cyano-3-nitro-2-pyridinyl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 115696998 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[(4-cyano-3-nitro-2-pyridinyl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNc1nccc(C#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N5O4/c1-20-5-4-13-9(17)7-15-11-10(16(18)19)8(6-12)2-3-14-11/h2-3H,4-5,7H2,1H3,(H,13,17)(H,14,15) |
| InChIKey | KEPVQIBSDVHFJK-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|