C10H10N4O — CID 115697836
5-[[(1-methylpyrazol-3-yl)amino]methyl]furan-2-carbonitrile (PubChem CID 115697836) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 5-[[(1-methylpyrazol-3-yl)amino]methyl]furan-2-carbonitrile.
| Compound Name | 5-[[(1-methylpyrazol-3-yl)amino]methyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 115697836 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 5-[[(1-methylpyrazol-3-yl)amino]methyl]furan-2-carbonitrile |
| SMILES | Cn1ccc(NCc2ccc(C#N)o2)n1 |
| InChI | InChI=1S/C10H10N4O/c1-14-5-4-10(13-14)12-7-9-3-2-8(6-11)15-9/h2-5H,7H2,1H3,(H,12,13) |
| InChIKey | RYLNQRISVYQMJY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |