C12H18N2 — CID 115698887
1-(2-methylcyclopropyl)-N-[(5-methyl-2-pyridinyl)methyl]methanamine (PubChem CID 115698887) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(2-methylcyclopropyl)-N-[(5-methyl-2-pyridinyl)methyl]methanamine.
| Compound Name | 1-(2-methylcyclopropyl)-N-[(5-methyl-2-pyridinyl)methyl]methanamine |
|---|---|
| PubChem CID | 115698887 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-(2-methylcyclopropyl)-N-[(5-methyl-2-pyridinyl)methyl]methanamine |
| SMILES | Cc1ccc(CNCC2CC2C)nc1 |
| InChI | InChI=1S/C12H18N2/c1-9-3-4-12(14-6-9)8-13-7-11-5-10(11)2/h3-4,6,10-11,13H,5,7-8H2,1-2H3 |
| InChIKey | RENMVTOWRMOYSZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |