C12H16N4 — CID 80709626
N-[(1-methylpyrazol-4-yl)methyl]-1-(5-methyl-2-pyridinyl)methanamine (PubChem CID 80709626) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-[(1-methylpyrazol-4-yl)methyl]-1-(5-methyl-2-pyridinyl)methanamine.
| Compound Name | N-[(1-methylpyrazol-4-yl)methyl]-1-(5-methyl-2-pyridinyl)methanamine |
|---|---|
| PubChem CID | 80709626 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-[(1-methylpyrazol-4-yl)methyl]-1-(5-methyl-2-pyridinyl)methanamine |
| SMILES | Cc1ccc(CNCc2cnn(C)c2)nc1 |
| InChI | InChI=1S/C12H16N4/c1-10-3-4-12(14-5-10)8-13-6-11-7-15-16(2)9-11/h3-5,7,9,13H,6,8H2,1-2H3 |
| InChIKey | XRXXQJFBJRVNRR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |