C12H16ClN3 — CID 126966764
N-[(1-methylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride (PubChem CID 126966764) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is N-[(1-methylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride.
| Compound Name | N-[(1-methylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 126966764 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-[(1-methylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride |
| SMILES | Cl.Cn1cc(CNCc2ccccc2)cn1 |
| InChI | InChI=1S/C12H15N3.ClH/c1-15-10-12(9-14-15)8-13-7-11-5-3-2-4-6-11;/h2-6,9-10,13H,7-8H2,1H3;1H |
| InChIKey | XXCJEJPBZIQPPI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |