C12H16ClN3O — CID 126964493
3-[[(1-methylpyrazol-4-yl)methylamino]methyl]phenol;hydrochloride (PubChem CID 126964493) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 3-[[(1-methylpyrazol-4-yl)methylamino]methyl]phenol;hydrochloride.
| Compound Name | 3-[[(1-methylpyrazol-4-yl)methylamino]methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 126964493 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-[[(1-methylpyrazol-4-yl)methylamino]methyl]phenol;hydrochloride |
| SMILES | Cl.Cn1cc(CNCc2cccc(O)c2)cn1 |
| InChI | InChI=1S/C12H15N3O.ClH/c1-15-9-11(8-14-15)7-13-6-10-3-2-4-12(16)5-10;/h2-5,8-9,13,16H,6-7H2,1H3;1H |
| InChIKey | SZKQNVOVPGSEDO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |