C25H30N8O3S — CID 11569942
4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)-N-phenylpiperazine-1-carboxamide (PubChem CID 11569942) has the molecular formula C25H30N8O3S and a molecular weight of 522.64 g/mol. Its IUPAC name is 4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 11569942 |
| Molecular Formula | C25H30N8O3S |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)-N-phenylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCN(c2cnc3nc2NCCCCNS(=O)(=O)c2cccc(c2)N3)CC1 |
| InChI | InChI=1S/C25H30N8O3S/c34-25(30-19-7-2-1-3-8-19)33-15-13-32(14-16-33)22-18-27-24-29-20-9-6-10-21(17-20)37(35,36)28-12-5-4-11-26-23(22)31-24/h1-3,6-10,17-18,28H,4-5,11-16H2,(H,30,34)(H2,26,27,29,31) |
| InChIKey | FONFHXXEMKUADO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |