C22H25N5O4S — CID 11705167
6-(2,4-dimethoxyphenyl)-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide (PubChem CID 11705167) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is 6-(2,4-dimethoxyphenyl)-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide.
| Compound Name | 6-(2,4-dimethoxyphenyl)-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide |
|---|---|
| PubChem CID | 11705167 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 6-(2,4-dimethoxyphenyl)-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide |
| SMILES | COc1ccc(-c2cnc3nc2NCCCCNS(=O)(=O)c2cccc(c2)N3)c(OC)c1 |
| InChI | InChI=1S/C22H25N5O4S/c1-30-16-8-9-18(20(13-16)31-2)19-14-24-22-26-15-6-5-7-17(12-15)32(28,29)25-11-4-3-10-23-21(19)27-22/h5-9,12-14,25H,3-4,10-11H2,1-2H3,(H2,23,24,26,27) |
| InChIKey | WIYVHLFLALNPFV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |