C22H25N5O3S — CID 11690715
6-[4-(methoxymethyl)phenyl]-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide (PubChem CID 11690715) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 6-[4-(methoxymethyl)phenyl]-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide.
| Compound Name | 6-[4-(methoxymethyl)phenyl]-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide |
|---|---|
| PubChem CID | 11690715 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 6-[4-(methoxymethyl)phenyl]-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene 14,14-dioxide |
| SMILES | COCc1ccc(-c2cnc3nc2NCCCCNS(=O)(=O)c2cccc(c2)N3)cc1 |
| InChI | InChI=1S/C22H25N5O3S/c1-30-15-16-7-9-17(10-8-16)20-14-24-22-26-18-5-4-6-19(13-18)31(28,29)25-12-3-2-11-23-21(20)27-22/h4-10,13-14,25H,2-3,11-12,15H2,1H3,(H2,23,24,26,27) |
| InChIKey | OFULVGMLSJURBG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |