C26H35N5OS — CID 143307277
ethane;13-imino-6-(4-methoxyphenyl)-13λ4-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaene;prop-1-ene (PubChem CID 143307277) has the molecular formula C26H35N5OS and a molecular weight of 465.67 g/mol. Its IUPAC name is ethane;13-imino-6-(4-methoxyphenyl)-13λ4-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaene;prop-1-ene.
| Compound Name | ethane;13-imino-6-(4-methoxyphenyl)-13λ4-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaene;prop-1-ene |
|---|---|
| PubChem CID | 143307277 |
| Molecular Formula | C26H35N5OS |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | ethane;13-imino-6-(4-methoxyphenyl)-13λ4-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaene;prop-1-ene |
| SMILES | C=CC.CC.[H]/N=S1\CCCCNc2nc(ncc2-c2ccc(OC)cc2)Nc2cccc1c2 |
| InChI | InChI=1S/C21H23N5OS.C3H6.C2H6/c1-27-17-9-7-15(8-10-17)19-14-24-21-25-16-5-4-6-18(13-16)28(22)12-3-2-11-23-20(19)26-21;1-3-2;1-2/h4-10,13-14,22H,2-3,11-12H2,1H3,(H2,23,24,25,26);3H,1H2,2H3;1-2H3 |
| InChIKey | FRKUFQIGGFKKTL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|