C8H17NO3 — CID 115701678
N-(3-hydroxy-2-methylpropyl)-2-methoxypropanamide (PubChem CID 115701678) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylpropyl)-2-methoxypropanamide.
| Compound Name | N-(3-hydroxy-2-methylpropyl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 115701678 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | N-(3-hydroxy-2-methylpropyl)-2-methoxypropanamide |
| SMILES | COC(C)C(=O)NCC(C)CO |
| InChI | InChI=1S/C8H17NO3/c1-6(5-10)4-9-8(11)7(2)12-3/h6-7,10H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | PNDIKMPFMOERGN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |