C10H21NO3Y — CID 58776208
N-(3-hydroxy-2-methylpropyl)-4-methoxy-3-methylbutanamide;yttrium (PubChem CID 58776208) has the molecular formula C10H21NO3Y and a molecular weight of 292.19 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylpropyl)-4-methoxy-3-methylbutanamide;yttrium.
| Compound Name | N-(3-hydroxy-2-methylpropyl)-4-methoxy-3-methylbutanamide;yttrium |
|---|---|
| PubChem CID | 58776208 |
| Molecular Formula | C10H21NO3Y |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-(3-hydroxy-2-methylpropyl)-4-methoxy-3-methylbutanamide;yttrium |
| SMILES | COCC(C)CC(=O)NCC(C)CO.[Y] |
| InChI | InChI=1S/C10H21NO3.Y/c1-8(7-14-3)4-10(13)11-5-9(2)6-12;/h8-9,12H,4-7H2,1-3H3,(H,11,13); |
| InChIKey | FJDWTCZQSQISNI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |