C8H17NO4 — CID 103253859
2-[(3-hydroxy-2-methylpropyl)amino]-3-methoxypropanoic acid (PubChem CID 103253859) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[(3-hydroxy-2-methylpropyl)amino]-3-methoxypropanoic acid.
| Compound Name | 2-[(3-hydroxy-2-methylpropyl)amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 103253859 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2-[(3-hydroxy-2-methylpropyl)amino]-3-methoxypropanoic acid |
| SMILES | COCC(NCC(C)CO)C(=O)O |
| InChI | InChI=1S/C8H17NO4/c1-6(4-10)3-9-7(5-13-2)8(11)12/h6-7,9-10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | XMYANEVSRNEAJK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |