C7H15NO5S — CID 103240234
3-methoxy-2-(2-methylsulfonylethylamino)propanoic acid (PubChem CID 103240234) has the molecular formula C7H15NO5S and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-methoxy-2-(2-methylsulfonylethylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(2-methylsulfonylethylamino)propanoic acid |
|---|---|
| PubChem CID | 103240234 |
| Molecular Formula | C7H15NO5S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 3-methoxy-2-(2-methylsulfonylethylamino)propanoic acid |
| SMILES | COCC(NCCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C7H15NO5S/c1-13-5-6(7(9)10)8-3-4-14(2,11)12/h6,8H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | PMYUPVWCAGVGJK-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |