C9H19NO4 — CID 103266484
3-methoxy-2-(2-propan-2-yloxyethylamino)propanoic acid (PubChem CID 103266484) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 3-methoxy-2-(2-propan-2-yloxyethylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(2-propan-2-yloxyethylamino)propanoic acid |
|---|---|
| PubChem CID | 103266484 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-methoxy-2-(2-propan-2-yloxyethylamino)propanoic acid |
| SMILES | COCC(NCCOC(C)C)C(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-7(2)14-5-4-10-8(6-13-3)9(11)12/h7-8,10H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | HYYBZGSKQUCCLQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|