C7H15N3O4 — CID 103262412
2-[2-(carbamoylamino)ethylamino]-3-methoxypropanoic acid (PubChem CID 103262412) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)ethylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[2-(carbamoylamino)ethylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 103262412 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-[2-(carbamoylamino)ethylamino]-3-methoxypropanoic acid |
| SMILES | COCC(NCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H15N3O4/c1-14-4-5(6(11)12)9-2-3-10-7(8)13/h5,9H,2-4H2,1H3,(H,11,12)(H3,8,10,13) |
| InChIKey | OQUCBCBWCNLYSB-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|