C11H22N2O6S — CID 81078633
2-[(2-amino-4-methylsulfonylbutanoyl)amino]-5-methoxypentanoic acid (PubChem CID 81078633) has the molecular formula C11H22N2O6S and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-[(2-amino-4-methylsulfonylbutanoyl)amino]-5-methoxypentanoic acid.
| Compound Name | 2-[(2-amino-4-methylsulfonylbutanoyl)amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81078633 |
| Molecular Formula | C11H22N2O6S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[(2-amino-4-methylsulfonylbutanoyl)amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)C(N)CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C11H22N2O6S/c1-19-6-3-4-9(11(15)16)13-10(14)8(12)5-7-20(2,17)18/h8-9H,3-7,12H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | QPDKTLWIEMLOCL-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|