C9H17N3O5 — CID 107824480
(2R)-4-amino-2-[(2-amino-4-methoxybutanoyl)amino]-4-oxobutanoic acid (PubChem CID 107824480) has the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2R)-4-amino-2-[(2-amino-4-methoxybutanoyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(2-amino-4-methoxybutanoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107824480 |
| Molecular Formula | C9H17N3O5 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (2R)-4-amino-2-[(2-amino-4-methoxybutanoyl)amino]-4-oxobutanoic acid |
| SMILES | COCCC(N)C(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O5/c1-17-3-2-5(10)8(14)12-6(9(15)16)4-7(11)13/h5-6H,2-4,10H2,1H3,(H2,11,13)(H,12,14)(H,15,16)/t5?,6-/m1/s1 |
| InChIKey | DSBAKTDITIKYAX-PRJDIBJQSA-N |
| XLogP | -2.20 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |