C8H16N2O5 — CID 62475206
2-[(2-amino-4-methoxybutanoyl)amino]-3-hydroxypropanoic acid (PubChem CID 62475206) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-[(2-amino-4-methoxybutanoyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(2-amino-4-methoxybutanoyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 62475206 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-[(2-amino-4-methoxybutanoyl)amino]-3-hydroxypropanoic acid |
| SMILES | COCCC(N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C8H16N2O5/c1-15-3-2-5(9)7(12)10-6(4-11)8(13)14/h5-6,11H,2-4,9H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | RSUPUEYEXFDTKQ-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |