C14H18BrNO — CID 115702280
2-bromo-N,5-dimethyl-N-pent-4-enylbenzamide (PubChem CID 115702280) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-bromo-N,5-dimethyl-N-pent-4-enylbenzamide.
| Compound Name | 2-bromo-N,5-dimethyl-N-pent-4-enylbenzamide |
|---|---|
| PubChem CID | 115702280 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-bromo-N,5-dimethyl-N-pent-4-enylbenzamide |
| SMILES | C=CCCCN(C)C(=O)c1cc(C)ccc1Br |
| InChI | InChI=1S/C14H18BrNO/c1-4-5-6-9-16(3)14(17)12-10-11(2)7-8-13(12)15/h4,7-8,10H,1,5-6,9H2,2-3H3 |
| InChIKey | PVDRJYSGSOCLSB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|