C13H15Br2NO — CID 103908739
3,5-dibromo-N-methyl-N-pent-4-enylbenzamide (PubChem CID 103908739) has the molecular formula C13H15Br2NO and a molecular weight of 361.08 g/mol. Its IUPAC name is 3,5-dibromo-N-methyl-N-pent-4-enylbenzamide.
| Compound Name | 3,5-dibromo-N-methyl-N-pent-4-enylbenzamide |
|---|---|
| PubChem CID | 103908739 |
| Molecular Formula | C13H15Br2NO |
| Molecular Weight | 361.08 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 3,5-dibromo-N-methyl-N-pent-4-enylbenzamide |
| SMILES | C=CCCCN(C)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H15Br2NO/c1-3-4-5-6-16(2)13(17)10-7-11(14)9-12(15)8-10/h3,7-9H,1,4-6H2,2H3 |
| InChIKey | ZKQCVJCPJIKRFO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.08 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|