C25H37Na2O10P+2 — CID 11570519
disodium;[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] hydrogen phosphate (PubChem CID 11570519) has the molecular formula C25H37Na2O10P+2 and a molecular weight of 574.52 g/mol. Its IUPAC name is disodium;[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] hydrogen phosphate.
| Compound Name | disodium;[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 11570519 |
| Molecular Formula | C25H37Na2O10P+2 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | disodium;[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] hydrogen phosphate |
| SMILES | C[C@]12CC[C@H](O)CC1=CCC1C2CC[C@@]2(C)C1CC[C@@H]2OP(=O)(O)OC1C(=O)OC(C(O)CO)C1=O.[Na+].[Na+] |
| InChI | InChI=1S/C25H37O10P.2Na/c1-24-9-7-14(27)11-13(24)3-4-15-16-5-6-19(25(16,2)10-8-17(15)24)34-36(31,32)35-22-20(29)21(18(28)12-26)33-23(22)30;;/h3,14-19,21-22,26-28H,4-12H2,1-2H3,(H,31,32);;/q;2*+1/t14-,15?,16?,17?,18?,19-,21?,22?,24-,25-;;/m0../s1 |
| InChIKey | HWYGAJQDJNHMOS-HEMYGPENSA-N |
| XLogP | -3.96 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|