C26H38NaO9P — CID 162192098
sodium [2-(1,2-dihydroxyethyl)-3-methyl-5-oxo-2H-furan-4-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phosphate (PubChem CID 162192098) has the molecular formula C26H38NaO9P and a molecular weight of 548.55 g/mol. Its IUPAC name is sodium [2-(1,2-dihydroxyethyl)-3-methyl-5-oxo-2H-furan-4-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phosphate.
| Compound Name | sodium [2-(1,2-dihydroxyethyl)-3-methyl-5-oxo-2H-furan-4-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phosphate |
|---|---|
| PubChem CID | 162192098 |
| Molecular Formula | C26H38NaO9P |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | sodium [2-(1,2-dihydroxyethyl)-3-methyl-5-oxo-2H-furan-4-yl] [(3S,10R,13S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phosphate |
| SMILES | CC1=C(OP(=O)([O-])O[C@H]2CCC3C4CC=C5C[C@@H](O)CC[C@]5(C)C4CC[C@@]32C)C(=O)OC1C(O)CO.[Na+] |
| InChI | InChI=1S/C26H39O9P.Na/c1-14-22(20(29)13-27)33-24(30)23(14)35-36(31,32)34-21-7-6-18-17-5-4-15-12-16(28)8-10-25(15,2)19(17)9-11-26(18,21)3;/h4,16-22,27-29H,5-13H2,1-3H3,(H,31,32);/q;+1/p-1/t16-,17?,18?,19?,20?,21-,22?,25-,26-;/m0./s1 |
| InChIKey | IBLKQTGVGMWSGY-OJVGPOBDSA-M |
| XLogP | -0.26 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|