C11H15F3N2 — CID 115705515
1,1,1-trifluoro-N-propan-2-yl-3-pyridin-4-ylpropan-2-amine (PubChem CID 115705515) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-propan-2-yl-3-pyridin-4-ylpropan-2-amine.
| Compound Name | 1,1,1-trifluoro-N-propan-2-yl-3-pyridin-4-ylpropan-2-amine |
|---|---|
| PubChem CID | 115705515 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1,1,1-trifluoro-N-propan-2-yl-3-pyridin-4-ylpropan-2-amine |
| SMILES | CC(C)NC(Cc1ccncc1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2/c1-8(2)16-10(11(12,13)14)7-9-3-5-15-6-4-9/h3-6,8,10,16H,7H2,1-2H3 |
| InChIKey | DOODTBTTXYANIK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |