C10H10F3NO — CID 132934559
1,1,1-trifluoro-3-methyl-4-pyridin-4-ylbutan-2-one (PubChem CID 132934559) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-methyl-4-pyridin-4-ylbutan-2-one.
| Compound Name | 1,1,1-trifluoro-3-methyl-4-pyridin-4-ylbutan-2-one |
|---|---|
| PubChem CID | 132934559 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1,1,1-trifluoro-3-methyl-4-pyridin-4-ylbutan-2-one |
| SMILES | CC(Cc1ccncc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO/c1-7(9(15)10(11,12)13)6-8-2-4-14-5-3-8/h2-5,7H,6H2,1H3 |
| InChIKey | BHVVSMGCVGBUJC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |