C12H19N3S — CID 115709441
N,N-dimethyl-3-[(thiolan-3-ylamino)methyl]pyridin-2-amine (PubChem CID 115709441) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is N,N-dimethyl-3-[(thiolan-3-ylamino)methyl]pyridin-2-amine.
| Compound Name | N,N-dimethyl-3-[(thiolan-3-ylamino)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115709441 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N,N-dimethyl-3-[(thiolan-3-ylamino)methyl]pyridin-2-amine |
| SMILES | CN(C)c1ncccc1CNC1CCSC1 |
| InChI | InChI=1S/C12H19N3S/c1-15(2)12-10(4-3-6-13-12)8-14-11-5-7-16-9-11/h3-4,6,11,14H,5,7-9H2,1-2H3 |
| InChIKey | NLWUINYGIGSNNG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |