C13H26N2O — CID 115710436
3-(1-cyclopropylpropan-2-ylamino)-N,N-diethylpropanamide (PubChem CID 115710436) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-(1-cyclopropylpropan-2-ylamino)-N,N-diethylpropanamide.
| Compound Name | 3-(1-cyclopropylpropan-2-ylamino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 115710436 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 3-(1-cyclopropylpropan-2-ylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC(C)CC1CC1 |
| InChI | InChI=1S/C13H26N2O/c1-4-15(5-2)13(16)8-9-14-11(3)10-12-6-7-12/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | ZJUJALRMOJHISX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |