C13H28N2O — CID 60926870
N,N-diethyl-3-(hexan-2-ylamino)propanamide (PubChem CID 60926870) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N,N-diethyl-3-(hexan-2-ylamino)propanamide.
| Compound Name | N,N-diethyl-3-(hexan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 60926870 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N,N-diethyl-3-(hexan-2-ylamino)propanamide |
| SMILES | CCCCC(C)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C13H28N2O/c1-5-8-9-12(4)14-11-10-13(16)15(6-2)7-3/h12,14H,5-11H2,1-4H3 |
| InChIKey | FZQXRASLTWPGFI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |