C14H30N2O — CID 54936007
N,N-diethyl-3-(heptylamino)propanamide (PubChem CID 54936007) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N,N-diethyl-3-(heptylamino)propanamide.
| Compound Name | N,N-diethyl-3-(heptylamino)propanamide |
|---|---|
| PubChem CID | 54936007 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N,N-diethyl-3-(heptylamino)propanamide |
| SMILES | CCCCCCCNCCC(=O)N(CC)CC |
| InChI | InChI=1S/C14H30N2O/c1-4-7-8-9-10-12-15-13-11-14(17)16(5-2)6-3/h15H,4-13H2,1-3H3 |
| InChIKey | QHYOHBNNJUUOBP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|