C12H18BrNS2 — CID 115710864
N-[(5-bromo-4-methylthiophen-2-yl)methyl]-1-(thian-4-yl)methanamine (PubChem CID 115710864) has the molecular formula C12H18BrNS2 and a molecular weight of 320.32 g/mol. Its IUPAC name is N-[(5-bromo-4-methylthiophen-2-yl)methyl]-1-(thian-4-yl)methanamine.
| Compound Name | N-[(5-bromo-4-methylthiophen-2-yl)methyl]-1-(thian-4-yl)methanamine |
|---|---|
| PubChem CID | 115710864 |
| Molecular Formula | C12H18BrNS2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | N-[(5-bromo-4-methylthiophen-2-yl)methyl]-1-(thian-4-yl)methanamine |
| SMILES | Cc1cc(CNCC2CCSCC2)sc1Br |
| InChI | InChI=1S/C12H18BrNS2/c1-9-6-11(16-12(9)13)8-14-7-10-2-4-15-5-3-10/h6,10,14H,2-5,7-8H2,1H3 |
| InChIKey | YNKMBWSVQGMWOW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |