C9H11Br2NS — CID 115710741
2-bromo-N-[(5-bromo-4-methylthiophen-2-yl)methyl]prop-2-en-1-amine (PubChem CID 115710741) has the molecular formula C9H11Br2NS and a molecular weight of 325.07 g/mol. Its IUPAC name is 2-bromo-N-[(5-bromo-4-methylthiophen-2-yl)methyl]prop-2-en-1-amine.
| Compound Name | 2-bromo-N-[(5-bromo-4-methylthiophen-2-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115710741 |
| Molecular Formula | C9H11Br2NS |
| Molecular Weight | 325.07 g/mol |
| Exact Mass | 322.90 |
| IUPAC Name | 2-bromo-N-[(5-bromo-4-methylthiophen-2-yl)methyl]prop-2-en-1-amine |
| SMILES | C=C(Br)CNCc1cc(C)c(Br)s1 |
| InChI | InChI=1S/C9H11Br2NS/c1-6-3-8(13-9(6)11)5-12-4-7(2)10/h3,12H,2,4-5H2,1H3 |
| InChIKey | IZYATPSVIBFMCK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.07 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |