C11H17NS — CID 65243483
N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylprop-2-en-1-amine (PubChem CID 65243483) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylprop-2-en-1-amine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 65243483 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CNCc1cc(C)c(C)s1 |
| InChI | InChI=1S/C11H17NS/c1-8(2)6-12-7-11-5-9(3)10(4)13-11/h5,12H,1,6-7H2,2-4H3 |
| InChIKey | VMDNIGSKHWTHFR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|