C11H17NO2S — CID 115710956
2-[(3-methoxythiophen-2-yl)methylamino]cyclopentan-1-ol (PubChem CID 115710956) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-[(3-methoxythiophen-2-yl)methylamino]cyclopentan-1-ol.
| Compound Name | 2-[(3-methoxythiophen-2-yl)methylamino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 115710956 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[(3-methoxythiophen-2-yl)methylamino]cyclopentan-1-ol |
| SMILES | COc1ccsc1CNC1CCCC1O |
| InChI | InChI=1S/C11H17NO2S/c1-14-10-5-6-15-11(10)7-12-8-3-2-4-9(8)13/h5-6,8-9,12-13H,2-4,7H2,1H3 |
| InChIKey | IAQCHISIOGXRTC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |