C8H13NO2S — CID 115710462
2-[(3-methoxythiophen-2-yl)methylamino]ethanol (PubChem CID 115710462) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 2-[(3-methoxythiophen-2-yl)methylamino]ethanol.
| Compound Name | 2-[(3-methoxythiophen-2-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 115710462 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2-[(3-methoxythiophen-2-yl)methylamino]ethanol |
| SMILES | COc1ccsc1CNCCO |
| InChI | InChI=1S/C8H13NO2S/c1-11-7-2-5-12-8(7)6-9-3-4-10/h2,5,9-10H,3-4,6H2,1H3 |
| InChIKey | KPUDXZMNLKEGHO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|