C11H18N2O2 — CID 115711461
3-(furan-3-ylmethylamino)-N,N-dimethylbutanamide (PubChem CID 115711461) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(furan-3-ylmethylamino)-N,N-dimethylbutanamide.
| Compound Name | 3-(furan-3-ylmethylamino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 115711461 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(furan-3-ylmethylamino)-N,N-dimethylbutanamide |
| SMILES | CC(CC(=O)N(C)C)NCc1ccoc1 |
| InChI | InChI=1S/C11H18N2O2/c1-9(6-11(14)13(2)3)12-7-10-4-5-15-8-10/h4-5,8-9,12H,6-7H2,1-3H3 |
| InChIKey | IECGHNDMMHYKDX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |