C38H32Cl4N2O4 — CID 11571255
N-[2-[[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carbonyl]amino]ethyl]-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide (PubChem CID 11571255) has the molecular formula C38H32Cl4N2O4 and a molecular weight of 722.50 g/mol. Its IUPAC name is N-[2-[[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carbonyl]amino]ethyl]-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide.
| Compound Name | N-[2-[[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carbonyl]amino]ethyl]-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide |
|---|---|
| PubChem CID | 11571255 |
| Molecular Formula | C38H32Cl4N2O4 |
| Molecular Weight | 722.50 g/mol |
| Exact Mass | 720.11 |
| IUPAC Name | N-[2-[[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carbonyl]amino]ethyl]-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide |
| SMILES | CC1=C(C(=O)NCCNC(=O)C2=C(C)OC(c3ccc(Cl)cc3)(c3ccc(Cl)cc3)C2)CC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C38H32Cl4N2O4/c1-23-33(21-37(47-23,25-3-11-29(39)12-4-25)26-5-13-30(40)14-6-26)35(45)43-19-20-44-36(46)34-22-38(48-24(34)2,27-7-15-31(41)16-8-27)28-9-17-32(42)18-10-28/h3-18H,19-22H2,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | SAUNEYYLFBQNLF-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.50 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|