C22H23Cl2NO2 — CID 10787384
N-tert-butyl-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide (PubChem CID 10787384) has the molecular formula C22H23Cl2NO2 and a molecular weight of 404.34 g/mol. Its IUPAC name is N-tert-butyl-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide.
| Compound Name | N-tert-butyl-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide |
|---|---|
| PubChem CID | 10787384 |
| Molecular Formula | C22H23Cl2NO2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-tert-butyl-2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-carboxamide |
| SMILES | CC1=C(C(=O)NC(C)(C)C)CC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C22H23Cl2NO2/c1-14-19(20(26)25-21(2,3)4)13-22(27-14,15-5-9-17(23)10-6-15)16-7-11-18(24)12-8-16/h5-12H,13H2,1-4H3,(H,25,26) |
| InChIKey | IXRXKSNTOXBFAM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |