C22H25NO2 — CID 10688221
N-butyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide (PubChem CID 10688221) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-butyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide.
| Compound Name | N-butyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide |
|---|---|
| PubChem CID | 10688221 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-butyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide |
| SMILES | CCCCNC(=O)C1=C(C)OC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO2/c1-3-4-15-23-21(24)20-16-22(25-17(20)2,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14H,3-4,15-16H2,1-2H3,(H,23,24) |
| InChIKey | KYBJFESRJFPNBF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|