C16H26N2O2 — CID 115712587
N,N-diethyl-2-[1-(2-methoxyphenyl)propan-2-ylamino]acetamide (PubChem CID 115712587) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N,N-diethyl-2-[1-(2-methoxyphenyl)propan-2-ylamino]acetamide.
| Compound Name | N,N-diethyl-2-[1-(2-methoxyphenyl)propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 115712587 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N,N-diethyl-2-[1-(2-methoxyphenyl)propan-2-ylamino]acetamide |
| SMILES | CCN(CC)C(=O)CNC(C)Cc1ccccc1OC |
| InChI | InChI=1S/C16H26N2O2/c1-5-18(6-2)16(19)12-17-13(3)11-14-9-7-8-10-15(14)20-4/h7-10,13,17H,5-6,11-12H2,1-4H3 |
| InChIKey | VFIMCYBARCXHFD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |