C13H22N2O — CID 115714513
1-[4-(butan-2-ylamino)butyl]pyridin-2-one (PubChem CID 115714513) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[4-(butan-2-ylamino)butyl]pyridin-2-one.
| Compound Name | 1-[4-(butan-2-ylamino)butyl]pyridin-2-one |
|---|---|
| PubChem CID | 115714513 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-[4-(butan-2-ylamino)butyl]pyridin-2-one |
| SMILES | CCC(C)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C13H22N2O/c1-3-12(2)14-9-5-7-11-15-10-6-4-8-13(15)16/h4,6,8,10,12,14H,3,5,7,9,11H2,1-2H3 |
| InChIKey | PFCNRYDXBXPADI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|