C12H19ClN2O — CID 82907582
1-[2-(5-chloropentan-2-ylamino)ethyl]pyridin-2-one (PubChem CID 82907582) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-[2-(5-chloropentan-2-ylamino)ethyl]pyridin-2-one.
| Compound Name | 1-[2-(5-chloropentan-2-ylamino)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 82907582 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[2-(5-chloropentan-2-ylamino)ethyl]pyridin-2-one |
| SMILES | CC(CCCCl)NCCn1ccccc1=O |
| InChI | InChI=1S/C12H19ClN2O/c1-11(5-4-7-13)14-8-10-15-9-3-2-6-12(15)16/h2-3,6,9,11,14H,4-5,7-8,10H2,1H3 |
| InChIKey | GKMJNXUVXOIMAJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|