C12H26N2O2 — CID 115715312
3-(1-methoxyhexan-2-ylamino)-N,N-dimethylpropanamide (PubChem CID 115715312) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(1-methoxyhexan-2-ylamino)-N,N-dimethylpropanamide.
| Compound Name | 3-(1-methoxyhexan-2-ylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 115715312 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-(1-methoxyhexan-2-ylamino)-N,N-dimethylpropanamide |
| SMILES | CCCCC(COC)NCCC(=O)N(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-5-6-7-11(10-16-4)13-9-8-12(15)14(2)3/h11,13H,5-10H2,1-4H3 |
| InChIKey | CWPJSIOQIMHCED-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |