C12H20N2OS — CID 115718385
N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxan-3-amine (PubChem CID 115718385) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxan-3-amine.
| Compound Name | N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxan-3-amine |
|---|---|
| PubChem CID | 115718385 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxan-3-amine |
| SMILES | Cc1nc(C)c(CCNC2CCCOC2)s1 |
| InChI | InChI=1S/C12H20N2OS/c1-9-12(16-10(2)14-9)5-6-13-11-4-3-7-15-8-11/h11,13H,3-8H2,1-2H3 |
| InChIKey | DSVIHDPWRLKNDO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |