C13H12N2S — CID 11572145
5-ethyl-2-methyl-4-(2-pyridin-3-ylethynyl)-1,3-thiazole (PubChem CID 11572145) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 5-ethyl-2-methyl-4-(2-pyridin-3-ylethynyl)-1,3-thiazole.
| Compound Name | 5-ethyl-2-methyl-4-(2-pyridin-3-ylethynyl)-1,3-thiazole |
|---|---|
| PubChem CID | 11572145 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 5-ethyl-2-methyl-4-(2-pyridin-3-ylethynyl)-1,3-thiazole |
| SMILES | CCc1sc(C)nc1C#Cc1cccnc1 |
| InChI | InChI=1S/C13H12N2S/c1-3-13-12(15-10(2)16-13)7-6-11-5-4-8-14-9-11/h4-5,8-9H,3H2,1-2H3 |
| InChIKey | SJJSHLRFCBWELS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|