C11H21N3O2 — CID 115722605
4-methoxy-3-[1-(1-methylpyrazol-4-yl)ethylamino]butan-1-ol (PubChem CID 115722605) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-methoxy-3-[1-(1-methylpyrazol-4-yl)ethylamino]butan-1-ol.
| Compound Name | 4-methoxy-3-[1-(1-methylpyrazol-4-yl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 115722605 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 4-methoxy-3-[1-(1-methylpyrazol-4-yl)ethylamino]butan-1-ol |
| SMILES | COCC(CCO)NC(C)c1cnn(C)c1 |
| InChI | InChI=1S/C11H21N3O2/c1-9(10-6-12-14(2)7-10)13-11(4-5-15)8-16-3/h6-7,9,11,13,15H,4-5,8H2,1-3H3 |
| InChIKey | YLAHRDUDBCYCOC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |