C12H20N2O2 — CID 115872140
4-methoxy-3-(1-pyridin-2-ylethylamino)butan-1-ol (PubChem CID 115872140) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-methoxy-3-(1-pyridin-2-ylethylamino)butan-1-ol.
| Compound Name | 4-methoxy-3-(1-pyridin-2-ylethylamino)butan-1-ol |
|---|---|
| PubChem CID | 115872140 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 4-methoxy-3-(1-pyridin-2-ylethylamino)butan-1-ol |
| SMILES | COCC(CCO)NC(C)c1ccccn1 |
| InChI | InChI=1S/C12H20N2O2/c1-10(12-5-3-4-7-13-12)14-11(6-8-15)9-16-2/h3-5,7,10-11,14-15H,6,8-9H2,1-2H3 |
| InChIKey | WTTGBLCVKUNURX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |