C17H23NO3 — CID 104582639
2-[1-[(4-hydroxy-1-methoxybutan-2-yl)amino]ethyl]naphthalen-1-ol (PubChem CID 104582639) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[1-[(4-hydroxy-1-methoxybutan-2-yl)amino]ethyl]naphthalen-1-ol.
| Compound Name | 2-[1-[(4-hydroxy-1-methoxybutan-2-yl)amino]ethyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 104582639 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[1-[(4-hydroxy-1-methoxybutan-2-yl)amino]ethyl]naphthalen-1-ol |
| SMILES | COCC(CCO)NC(C)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C17H23NO3/c1-12(18-14(9-10-19)11-21-2)15-8-7-13-5-3-4-6-16(13)17(15)20/h3-8,12,14,18-20H,9-11H2,1-2H3 |
| InChIKey | XPKLYNIWSRTFPB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|