C15H29NO — CID 115723043
3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentan-1-ol (PubChem CID 115723043) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentan-1-ol.
| Compound Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 115723043 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentan-1-ol |
| SMILES | CCC(CCO)NC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C15H29NO/c1-2-14(9-10-17)16-15-8-7-12-5-3-4-6-13(12)11-15/h12-17H,2-11H2,1H3 |
| InChIKey | VFNJIHPEIDJMHN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |