C10H18N4S — CID 115725045
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiolan-3-amine (PubChem CID 115725045) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiolan-3-amine.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 115725045 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiolan-3-amine |
| SMILES | CCc1nncn1CCNC1CCSC1 |
| InChI | InChI=1S/C10H18N4S/c1-2-10-13-12-8-14(10)5-4-11-9-3-6-15-7-9/h8-9,11H,2-7H2,1H3 |
| InChIKey | YPHAXSFUAWTORZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |