C16H21N3S2 — CID 115727375
N-(1,4-dithian-2-ylmethyl)-1-(4-imidazol-1-ylphenyl)ethanamine (PubChem CID 115727375) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1-(4-imidazol-1-ylphenyl)ethanamine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1-(4-imidazol-1-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 115727375 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1-(4-imidazol-1-ylphenyl)ethanamine |
| SMILES | CC(NCC1CSCCS1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C16H21N3S2/c1-13(18-10-16-11-20-8-9-21-16)14-2-4-15(5-3-14)19-7-6-17-12-19/h2-7,12-13,16,18H,8-11H2,1H3 |
| InChIKey | MFNQEJAGXWVVNH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |